C23H28N4 — CID 1441230
2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 1441230) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 1441230 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-11-(3-methylphenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | Cc1cccc(-c2cc3nc4c(c(N5C[C@@H](C)C[C@H](C)C5)n3n2)CCC4)c1 |
| InChI | InChI=1S/C23H28N4/c1-15-6-4-7-18(11-15)21-12-22-24-20-9-5-8-19(20)23(27(22)25-21)26-13-16(2)10-17(3)14-26/h4,6-7,11-12,16-17H,5,8-10,13-14H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | QNXSKFGTXRPOHF-IRXDYDNUSA-N |
| XLogP | 4.68 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |