C18H21ClF3N3 — CID 146588997
8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene (PubChem CID 146588997) has the molecular formula C18H21ClF3N3 and a molecular weight of 371.83 g/mol. Its IUPAC name is 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene.
| Compound Name | 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 146588997 |
| Molecular Formula | C18H21ClF3N3 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-2,6,7-triazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
| SMILES | FC(F)(F)C1CCC(c2cc3nc4c(c(Cl)n3n2)CCCCC4)CC1 |
| InChI | InChI=1S/C18H21ClF3N3/c19-17-13-4-2-1-3-5-14(13)23-16-10-15(24-25(16)17)11-6-8-12(9-7-11)18(20,21)22/h10-12H,1-9H2 |
| InChIKey | QVFKFENQWSYDFB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |