C23H23N5 — CID 1441157
11-(4-methylphenyl)-N-(2-pyridin-2-ylethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 1441157) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 11-(4-methylphenyl)-N-(2-pyridin-2-ylethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 11-(4-methylphenyl)-N-(2-pyridin-2-ylethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 1441157 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 11-(4-methylphenyl)-N-(2-pyridin-2-ylethyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Cc1ccc(-c2cc3nc4c(c(NCCc5ccccn5)n3n2)CCC4)cc1 |
| InChI | InChI=1S/C23H23N5/c1-16-8-10-17(11-9-16)21-15-22-26-20-7-4-6-19(20)23(28(22)27-21)25-14-12-18-5-2-3-13-24-18/h2-3,5,8-11,13,15,25H,4,6-7,12,14H2,1H3 |
| InChIKey | ZHMADIJQLALACV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |