C23H21FN4O2 — CID 7435746
3-[(1R)-2-[[11-(4-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]-1-hydroxyethyl]phenol (PubChem CID 7435746) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is 3-[(1R)-2-[[11-(4-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]-1-hydroxyethyl]phenol.
| Compound Name | 3-[(1R)-2-[[11-(4-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 7435746 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[(1R)-2-[[11-(4-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]amino]-1-hydroxyethyl]phenol |
| SMILES | Oc1cccc([C@@H](O)CNc2c3c(nc4cc(-c5ccc(F)cc5)nn24)CCC3)c1 |
| InChI | InChI=1S/C23H21FN4O2/c24-16-9-7-14(8-10-16)20-12-22-26-19-6-2-5-18(19)23(28(22)27-20)25-13-21(30)15-3-1-4-17(29)11-15/h1,3-4,7-12,21,25,29-30H,2,5-6,13H2/t21-/m0/s1 |
| InChIKey | PHAZDODXVHSDDQ-NRFANRHFSA-N |
| XLogP | 3.88 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |