C21H26BN5O — CID 143440464
ethane;3-[7-methoxy-3-(6-methyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile (PubChem CID 143440464) has the molecular formula C21H26BN5O and a molecular weight of 375.29 g/mol. Its IUPAC name is ethane;3-[7-methoxy-3-(6-methyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile.
| Compound Name | ethane;3-[7-methoxy-3-(6-methyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile |
|---|---|
| PubChem CID | 143440464 |
| Molecular Formula | C21H26BN5O |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | ethane;3-[7-methoxy-3-(6-methyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile |
| SMILES | CC.COc1cc(C2CCCB(C#N)C2)nc2c(-c3ccc(C)nc3)cnn12 |
| InChI | InChI=1S/C19H20BN5O.C2H6/c1-13-5-6-15(10-22-13)16-11-23-25-18(26-2)8-17(24-19(16)25)14-4-3-7-20(9-14)12-21;1-2/h5-6,8,10-11,14H,3-4,7,9H2,1-2H3;1-2H3 |
| InChIKey | HGFBCLNPUWWWLY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|