C19H19BN4O — CID 143441153
3-(7-methoxy-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl)borinane-1-carbonitrile (PubChem CID 143441153) has the molecular formula C19H19BN4O and a molecular weight of 330.20 g/mol. Its IUPAC name is 3-(7-methoxy-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl)borinane-1-carbonitrile.
| Compound Name | 3-(7-methoxy-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl)borinane-1-carbonitrile |
|---|---|
| PubChem CID | 143441153 |
| Molecular Formula | C19H19BN4O |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-(7-methoxy-3-phenylpyrazolo[1,5-a]pyrimidin-5-yl)borinane-1-carbonitrile |
| SMILES | COc1cc(C2CCCB(C#N)C2)nc2c(-c3ccccc3)cnn12 |
| InChI | InChI=1S/C19H19BN4O/c1-25-18-10-17(15-8-5-9-20(11-15)13-21)23-19-16(12-22-24(18)19)14-6-3-2-4-7-14/h2-4,6-7,10,12,15H,5,8-9,11H2,1H3 |
| InChIKey | AWYLLGCTVTWWTG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|