C20H23BN4O3 — CID 143656240
ethane;3-[3-(5-formylfuran-3-yl)-7-methoxypyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile (PubChem CID 143656240) has the molecular formula C20H23BN4O3 and a molecular weight of 378.24 g/mol. Its IUPAC name is ethane;3-[3-(5-formylfuran-3-yl)-7-methoxypyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile.
| Compound Name | ethane;3-[3-(5-formylfuran-3-yl)-7-methoxypyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile |
|---|---|
| PubChem CID | 143656240 |
| Molecular Formula | C20H23BN4O3 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethane;3-[3-(5-formylfuran-3-yl)-7-methoxypyrazolo[1,5-a]pyrimidin-5-yl]borinane-1-carbonitrile |
| SMILES | CC.COc1cc(C2CCCB(C#N)C2)nc2c(-c3coc(C=O)c3)cnn12 |
| InChI | InChI=1S/C18H17BN4O3.C2H6/c1-25-17-6-16(12-3-2-4-19(7-12)11-20)22-18-15(8-21-23(17)18)13-5-14(9-24)26-10-13;1-2/h5-6,8-10,12H,2-4,7H2,1H3;1-2H3 |
| InChIKey | FYLJZTFGHCMPKS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|