C23H34N2O5 — CID 143444042
(3Z,5Z)-3-ethylhepta-1,3,5-triene;2-formamido-N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide;methyl formate (PubChem CID 143444042) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is (3Z,5Z)-3-ethylhepta-1,3,5-triene;2-formamido-N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide;methyl formate.
| Compound Name | (3Z,5Z)-3-ethylhepta-1,3,5-triene;2-formamido-N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide;methyl formate |
|---|---|
| PubChem CID | 143444042 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (3Z,5Z)-3-ethylhepta-1,3,5-triene;2-formamido-N-[1-(4-hydroxyphenyl)propan-2-yl]acetamide;methyl formate |
| SMILES | C=C/C(=C\C=C/C)CC.CC(Cc1ccc(O)cc1)NC(=O)CNC=O.COC=O |
| InChI | InChI=1S/C12H16N2O3.C9H14.C2H4O2/c1-9(14-12(17)7-13-8-15)6-10-2-4-11(16)5-3-10;1-4-7-8-9(5-2)6-3;1-4-2-3/h2-5,8-9,16H,6-7H2,1H3,(H,13,15)(H,14,17);4-5,7-8H,2,6H2,1,3H3;2H,1H3/b;7-4-,9-8+; |
| InChIKey | UENJLCWVPZBUID-MOSSHJLKSA-N |
| XLogP | 3.06 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|