C13H21NO2 — CID 90051620
[[(1Z,3Z)-4-ethylhexa-1,3,5-trienyl]amino]methyl 2-methylpropanoate (PubChem CID 90051620) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is [[(1Z,3Z)-4-ethylhexa-1,3,5-trienyl]amino]methyl 2-methylpropanoate.
| Compound Name | [[(1Z,3Z)-4-ethylhexa-1,3,5-trienyl]amino]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 90051620 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | [[(1Z,3Z)-4-ethylhexa-1,3,5-trienyl]amino]methyl 2-methylpropanoate |
| SMILES | C=C/C(=C\C=C/NCOC(=O)C(C)C)CC |
| InChI | InChI=1S/C13H21NO2/c1-5-12(6-2)8-7-9-14-10-16-13(15)11(3)4/h5,7-9,11,14H,1,6,10H2,2-4H3/b9-7-,12-8+ |
| InChIKey | ZUQTWWWMQMUFEB-ZUQSVMQASA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|