C22H33N3O — CID 143444439
(2S)-2-amino-1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-3-phenylpropan-1-one;ethane (PubChem CID 143444439) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-3-phenylpropan-1-one;ethane.
| Compound Name | (2S)-2-amino-1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-3-phenylpropan-1-one;ethane |
|---|---|
| PubChem CID | 143444439 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | (2S)-2-amino-1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-3-phenylpropan-1-one;ethane |
| SMILES | C=C/C=C(\C=C)CN1CCN(C(=O)[C@@H](N)Cc2ccccc2)CC1.CC |
| InChI | InChI=1S/C20H27N3O.C2H6/c1-3-8-17(4-2)16-22-11-13-23(14-12-22)20(24)19(21)15-18-9-6-5-7-10-18;1-2/h3-10,19H,1-2,11-16,21H2;1-2H3/b17-8+;/t19-;/m0./s1 |
| InChIKey | QUJQLKFVJHIVDE-ZSENZDLLSA-N |
| XLogP | 3.03 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|