C29H34N4O — CID 143444481
1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-2-(1H-indol-5-ylmethylamino)-3-phenylpropan-1-one (PubChem CID 143444481) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-2-(1H-indol-5-ylmethylamino)-3-phenylpropan-1-one.
| Compound Name | 1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-2-(1H-indol-5-ylmethylamino)-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 143444481 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazin-1-yl]-2-(1H-indol-5-ylmethylamino)-3-phenylpropan-1-one |
| SMILES | C=C/C=C(\C=C)CN1CCN(C(=O)C(Cc2ccccc2)NCc2ccc3[nH]ccc3c2)CC1 |
| InChI | InChI=1S/C29H34N4O/c1-3-8-23(4-2)22-32-15-17-33(18-16-32)29(34)28(20-24-9-6-5-7-10-24)31-21-25-11-12-27-26(19-25)13-14-30-27/h3-14,19,28,30-31H,1-2,15-18,20-22H2/b23-8+ |
| InChIKey | MYCGXQQEJVGLPB-LIMNOBDPSA-N |
| XLogP | 4.31 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|