C22H22N4OS — CID 143445615
S-[4-[2-[[4-(3H-benzimidazol-5-yloxy)phenyl]methylamino]ethyl]phenyl]thiohydroxylamine (PubChem CID 143445615) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is S-[4-[2-[[4-(3H-benzimidazol-5-yloxy)phenyl]methylamino]ethyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[2-[[4-(3H-benzimidazol-5-yloxy)phenyl]methylamino]ethyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 143445615 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | S-[4-[2-[[4-(3H-benzimidazol-5-yloxy)phenyl]methylamino]ethyl]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(CCNCc2ccc(Oc3ccc4nc[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4OS/c23-28-20-8-3-16(4-9-20)11-12-24-14-17-1-5-18(6-2-17)27-19-7-10-21-22(13-19)26-15-25-21/h1-10,13,15,24H,11-12,14,23H2,(H,25,26) |
| InChIKey | DIFDMUMFZHVTHI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|