C21H18ClNOS — CID 143446650
(Z)-5-[5-(3-chlorophenyl)-3-methyl-1,4-benzothiazepin-2-yl]pent-3-enal (PubChem CID 143446650) has the molecular formula C21H18ClNOS and a molecular weight of 367.90 g/mol. Its IUPAC name is (Z)-5-[5-(3-chlorophenyl)-3-methyl-1,4-benzothiazepin-2-yl]pent-3-enal.
| Compound Name | (Z)-5-[5-(3-chlorophenyl)-3-methyl-1,4-benzothiazepin-2-yl]pent-3-enal |
|---|---|
| PubChem CID | 143446650 |
| Molecular Formula | C21H18ClNOS |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (Z)-5-[5-(3-chlorophenyl)-3-methyl-1,4-benzothiazepin-2-yl]pent-3-enal |
| SMILES | CC1=C(C/C=C\CC=O)Sc2ccccc2C(c2cccc(Cl)c2)=N1 |
| InChI | InChI=1S/C21H18ClNOS/c1-15-19(11-3-2-6-13-24)25-20-12-5-4-10-18(20)21(23-15)16-8-7-9-17(22)14-16/h2-5,7-10,12-14H,6,11H2,1H3/b3-2- |
| InChIKey | FNWFCIVQLCYOFI-IHWYPQMZSA-N |
| XLogP | 6.05 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|