C30H26ClN3OS — CID 140513848
6-(3-chlorophenyl)-N-[1-(4-ethylanilino)ethyl]benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 140513848) has the molecular formula C30H26ClN3OS and a molecular weight of 512.08 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-N-[1-(4-ethylanilino)ethyl]benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-(3-chlorophenyl)-N-[1-(4-ethylanilino)ethyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 140513848 |
| Molecular Formula | C30H26ClN3OS |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 6-(3-chlorophenyl)-N-[1-(4-ethylanilino)ethyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCc1ccc(NC(C)NC(=O)c2ccc3c(c2)N=C(c2cccc(Cl)c2)c2ccccc2S3)cc1 |
| InChI | InChI=1S/C30H26ClN3OS/c1-3-20-11-14-24(15-12-20)32-19(2)33-30(35)22-13-16-28-26(18-22)34-29(21-7-6-8-23(31)17-21)25-9-4-5-10-27(25)36-28/h4-19,32H,3H2,1-2H3,(H,33,35) |
| InChIKey | KUJZAFMHRKZQHG-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|