C29H25ClN2OS — CID 145482778
2-(3-chlorophenyl)-N-methylethanamine;6-phenylbenzo[b][1,4]benzothiazepine-3-carbaldehyde (PubChem CID 145482778) has the molecular formula C29H25ClN2OS and a molecular weight of 485.05 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-methylethanamine;6-phenylbenzo[b][1,4]benzothiazepine-3-carbaldehyde.
| Compound Name | 2-(3-chlorophenyl)-N-methylethanamine;6-phenylbenzo[b][1,4]benzothiazepine-3-carbaldehyde |
|---|---|
| PubChem CID | 145482778 |
| Molecular Formula | C29H25ClN2OS |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-(3-chlorophenyl)-N-methylethanamine;6-phenylbenzo[b][1,4]benzothiazepine-3-carbaldehyde |
| SMILES | CNCCc1cccc(Cl)c1.O=Cc1ccc2c(c1)N=C(c1ccccc1)c1ccccc1S2 |
| InChI | InChI=1S/C20H13NOS.C9H12ClN/c22-13-14-10-11-19-17(12-14)21-20(15-6-2-1-3-7-15)16-8-4-5-9-18(16)23-19;1-11-6-5-8-3-2-4-9(10)7-8/h1-13H;2-4,7,11H,5-6H2,1H3 |
| InChIKey | JGOQOIITWQSTIP-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|