C30H41N3O2 — CID 143447137
N-(cyclohexylmethyl)-1-(4-propoxyphenyl)indole-2-carboxamide;2-methylpyrrolidine (PubChem CID 143447137) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-(4-propoxyphenyl)indole-2-carboxamide;2-methylpyrrolidine.
| Compound Name | N-(cyclohexylmethyl)-1-(4-propoxyphenyl)indole-2-carboxamide;2-methylpyrrolidine |
|---|---|
| PubChem CID | 143447137 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-(cyclohexylmethyl)-1-(4-propoxyphenyl)indole-2-carboxamide;2-methylpyrrolidine |
| SMILES | CC1CCCN1.CCCOc1ccc(-n2c(C(=O)NCC3CCCCC3)cc3ccccc32)cc1 |
| InChI | InChI=1S/C25H30N2O2.C5H11N/c1-2-16-29-22-14-12-21(13-15-22)27-23-11-7-6-10-20(23)17-24(27)25(28)26-18-19-8-4-3-5-9-19;1-5-3-2-4-6-5/h6-7,10-15,17,19H,2-5,8-9,16,18H2,1H3,(H,26,28);5-6H,2-4H2,1H3 |
| InChIKey | MOFCNNHFPQXJBM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |