C21H21F4NO — CID 143447303
6-phenylmethoxy-2-(3,3,4,4-tetrafluoropent-1-en-2-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 143447303) has the molecular formula C21H21F4NO and a molecular weight of 379.40 g/mol. Its IUPAC name is 6-phenylmethoxy-2-(3,3,4,4-tetrafluoropent-1-en-2-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-phenylmethoxy-2-(3,3,4,4-tetrafluoropent-1-en-2-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143447303 |
| Molecular Formula | C21H21F4NO |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 6-phenylmethoxy-2-(3,3,4,4-tetrafluoropent-1-en-2-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | C=C(N1CCc2cc(OCc3ccccc3)ccc2C1)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C21H21F4NO/c1-15(21(24,25)20(2,22)23)26-11-10-17-12-19(9-8-18(17)13-26)27-14-16-6-4-3-5-7-16/h3-9,12H,1,10-11,13-14H2,2H3 |
| InChIKey | FDPHEPUAIQHKHU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|