C12H18O3 — CID 143448424
(1,2-dimethyl-3-tricyclo[3.2.0.02,7]heptanyl)oxymethyl acetate (PubChem CID 143448424) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1,2-dimethyl-3-tricyclo[3.2.0.02,7]heptanyl)oxymethyl acetate.
| Compound Name | (1,2-dimethyl-3-tricyclo[3.2.0.02,7]heptanyl)oxymethyl acetate |
|---|---|
| PubChem CID | 143448424 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1,2-dimethyl-3-tricyclo[3.2.0.02,7]heptanyl)oxymethyl acetate |
| SMILES | CC(=O)OCOC1CC2CC3C2(C)C13C |
| InChI | InChI=1S/C12H18O3/c1-7(13)14-6-15-10-5-8-4-9-11(8,2)12(9,10)3/h8-10H,4-6H2,1-3H3 |
| InChIKey | ABNFZXYURCGTGU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|