C17H28O3 — CID 166643255
[(1S,2R,5S,7R,8R)-8-hydroxy-2,6,8-trimethyl-6-tricyclo[5.3.1.01,5]undecanyl]methyl acetate (PubChem CID 166643255) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(1S,2R,5S,7R,8R)-8-hydroxy-2,6,8-trimethyl-6-tricyclo[5.3.1.01,5]undecanyl]methyl acetate.
| Compound Name | [(1S,2R,5S,7R,8R)-8-hydroxy-2,6,8-trimethyl-6-tricyclo[5.3.1.01,5]undecanyl]methyl acetate |
|---|---|
| PubChem CID | 166643255 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(1S,2R,5S,7R,8R)-8-hydroxy-2,6,8-trimethyl-6-tricyclo[5.3.1.01,5]undecanyl]methyl acetate |
| SMILES | CC(=O)OCC1(C)[C@H]2CC[C@@H](C)[C@@]23CC[C@@](C)(O)[C@@H]1C3 |
| InChI | InChI=1S/C17H28O3/c1-11-5-6-13-15(3,10-20-12(2)18)14-9-17(11,13)8-7-16(14,4)19/h11,13-14,19H,5-10H2,1-4H3/t11-,13-,14-,15?,16-,17+/m1/s1 |
| InChIKey | ZLMHNCPQIVGXFK-LGXLZINCSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |