C13H20FIO2 — CID 139473808
[(5R,7S,8R)-3-fluoro-5-iodo-7,8-dimethylspiro[3.4]octan-8-yl]methyl acetate (PubChem CID 139473808) has the molecular formula C13H20FIO2 and a molecular weight of 354.20 g/mol. Its IUPAC name is [(5R,7S,8R)-3-fluoro-5-iodo-7,8-dimethylspiro[3.4]octan-8-yl]methyl acetate.
| Compound Name | [(5R,7S,8R)-3-fluoro-5-iodo-7,8-dimethylspiro[3.4]octan-8-yl]methyl acetate |
|---|---|
| PubChem CID | 139473808 |
| Molecular Formula | C13H20FIO2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [(5R,7S,8R)-3-fluoro-5-iodo-7,8-dimethylspiro[3.4]octan-8-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)[C@@H](C)C[C@@H](I)C12CCC2F |
| InChI | InChI=1S/C13H20FIO2/c1-8-6-11(15)13(5-4-10(13)14)12(8,3)7-17-9(2)16/h8,10-11H,4-7H2,1-3H3/t8-,10?,11+,12+,13?/m0/s1 |
| InChIKey | COCIHCZYEPFNMM-TWFLLJKNSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|