C9H12F2O3 — CID 166561330
[(1R,3S)-2,2-difluoro-1-methyl-3-(2-oxoethyl)cyclopropyl]methyl acetate (PubChem CID 166561330) has the molecular formula C9H12F2O3 and a molecular weight of 206.19 g/mol. Its IUPAC name is [(1R,3S)-2,2-difluoro-1-methyl-3-(2-oxoethyl)cyclopropyl]methyl acetate.
| Compound Name | [(1R,3S)-2,2-difluoro-1-methyl-3-(2-oxoethyl)cyclopropyl]methyl acetate |
|---|---|
| PubChem CID | 166561330 |
| Molecular Formula | C9H12F2O3 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [(1R,3S)-2,2-difluoro-1-methyl-3-(2-oxoethyl)cyclopropyl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1(C)[C@H](CC=O)C1(F)F |
| InChI | InChI=1S/C9H12F2O3/c1-6(13)14-5-8(2)7(3-4-12)9(8,10)11/h4,7H,3,5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | KZSXWKSTTSTGDI-YUMQZZPRSA-N |
| XLogP | 1.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|