C17H29BrO3 — CID 66806803
[(3R,4S,4aR,7S,8aR)-7-bromo-3-hydroxy-3,4,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate (PubChem CID 66806803) has the molecular formula C17H29BrO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is [(3R,4S,4aR,7S,8aR)-7-bromo-3-hydroxy-3,4,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate.
| Compound Name | [(3R,4S,4aR,7S,8aR)-7-bromo-3-hydroxy-3,4,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 66806803 |
| Molecular Formula | C17H29BrO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [(3R,4S,4aR,7S,8aR)-7-bromo-3-hydroxy-3,4,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC[C@H](Br)C(C)(C)[C@@H]1CC[C@@](C)(O)[C@H]2C |
| InChI | InChI=1S/C17H29BrO3/c1-11-16(5,20)8-6-13-15(3,4)14(18)7-9-17(11,13)10-21-12(2)19/h11,13-14,20H,6-10H2,1-5H3/t11-,13+,14+,16-,17+/m1/s1 |
| InChIKey | WXQUNVBMBABPSJ-VJOHVRBBSA-N |
| XLogP | 3.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|