C13H13ClO2 — CID 143450624
5-(2-chloro-6-methylphenyl)cyclohexane-1,3-dione (PubChem CID 143450624) has the molecular formula C13H13ClO2 and a molecular weight of 236.70 g/mol. Its IUPAC name is 5-(2-chloro-6-methylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(2-chloro-6-methylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 143450624 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5-(2-chloro-6-methylphenyl)cyclohexane-1,3-dione |
| SMILES | Cc1cccc(Cl)c1C1CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C13H13ClO2/c1-8-3-2-4-12(14)13(8)9-5-10(15)7-11(16)6-9/h2-4,9H,5-7H2,1H3 |
| InChIKey | KAMXWFHKDHKTKC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|