C24H33NO2S — CID 143451038
2-(4-cyclopropylsulfanylphenyl)-N-hept-1-en-2-yl-3-(3-oxocyclopentyl)propanamide (PubChem CID 143451038) has the molecular formula C24H33NO2S and a molecular weight of 399.60 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfanylphenyl)-N-hept-1-en-2-yl-3-(3-oxocyclopentyl)propanamide.
| Compound Name | 2-(4-cyclopropylsulfanylphenyl)-N-hept-1-en-2-yl-3-(3-oxocyclopentyl)propanamide |
|---|---|
| PubChem CID | 143451038 |
| Molecular Formula | C24H33NO2S |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(4-cyclopropylsulfanylphenyl)-N-hept-1-en-2-yl-3-(3-oxocyclopentyl)propanamide |
| SMILES | C=C(CCCCC)NC(=O)C(CC1CCC(=O)C1)c1ccc(SC2CC2)cc1 |
| InChI | InChI=1S/C24H33NO2S/c1-3-4-5-6-17(2)25-24(27)23(16-18-7-10-20(26)15-18)19-8-11-21(12-9-19)28-22-13-14-22/h8-9,11-12,18,22-23H,2-7,10,13-16H2,1H3,(H,25,27) |
| InChIKey | GOPLXAINDCFYEK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|