About hexadecan-2-one;3-undecylcyclopentan-1-one
hexadecan-2-one;3-undecylcyclopentan-1-one (PubChem CID 69382270) has the molecular formula C32H62O2
and a molecular weight of 478.85 g/mol. Its IUPAC name is hexadecan-2-one;3-undecylcyclopentan-1-one.
Molecular Properties
| Compound Name | hexadecan-2-one;3-undecylcyclopentan-1-one |
| PubChem CID | 69382270 |
| Molecular Formula | C32H62O2 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.47 |
| IUPAC Name | hexadecan-2-one;3-undecylcyclopentan-1-one |
| SMILES | CCCCCCCCCCCC1CCC(=O)C1.CCCCCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C16H30O.C16H32O/c1-2-3-4-5-6-7-8-9-10-11-15-12-13-16(17)14-15;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17/h15H,2-14H2,1H3;3-15H2,1-2H3 |
| InChIKey | QKVYLUQUWMSNOC-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-2-one;3-undecylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-2-one;3-undecylcyclopentan-1-one?
The IUPAC name of hexadecan-2-one;3-undecylcyclopentan-1-one (CID 69382270) is hexadecan-2-one;3-undecylcyclopentan-1-one.
What is the SMILES notation for hexadecan-2-one;3-undecylcyclopentan-1-one?
The canonical SMILES for hexadecan-2-one;3-undecylcyclopentan-1-one is CCCCCCCCCCCC1CCC(=O)C1.CCCCCCCCCCCCCCC(C)=O.
What is the InChIKey of hexadecan-2-one;3-undecylcyclopentan-1-one?
The InChIKey is QKVYLUQUWMSNOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O.C16H32O/c1-2-3-4-5-6-7-8-9-10-11-15-12-13-16(17)14-15;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17/h15H,2-14H2,1H3;3-15H2,1-2H3.
What are the key properties of hexadecan-2-one;3-undecylcyclopentan-1-one?
hexadecan-2-one;3-undecylcyclopentan-1-one has a molecular weight of 478.85 g/mol, XLogP of 10.94, 23 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-2-one;3-undecylcyclopentan-1-one is sourced from PubChem (CID 69382270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).