About ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol
ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol (PubChem CID 143451254) has the molecular formula C18H27FO3
and a molecular weight of 310.41 g/mol. Its IUPAC name is ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol.
Molecular Properties
| Compound Name | ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol |
| PubChem CID | 143451254 |
| Molecular Formula | C18H27FO3 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol |
| SMILES | CC.CCCc1ccc(OC2=C(F)CCC=C2)cc1.OCO |
| InChI | InChI=1S/C15H17FO.C2H6.CH4O2/c1-2-5-12-8-10-13(11-9-12)17-15-7-4-3-6-14(15)16;1-2;2-1-3/h4,7-11H,2-3,5-6H2,1H3;1-2H3;2-3H,1H2 |
| InChIKey | ONUKTVGZNZMFOA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol?
The IUPAC name of ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol (CID 143451254) is ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol.
What is the SMILES notation for ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol?
The canonical SMILES for ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol is CC.CCCc1ccc(OC2=C(F)CCC=C2)cc1.OCO.
What is the InChIKey of ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol?
The InChIKey is ONUKTVGZNZMFOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FO.C2H6.CH4O2/c1-2-5-12-8-10-13(11-9-12)17-15-7-4-3-6-14(15)16;1-2;2-1-3/h4,7-11H,2-3,5-6H2,1H3;1-2H3;2-3H,1H2.
What are the key properties of ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol?
ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol has a molecular weight of 310.41 g/mol, XLogP of 4.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene;methanediol is sourced from PubChem (CID 143451254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).