C15H17FO — CID 143451273
1-(5-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene (PubChem CID 143451273) has the molecular formula C15H17FO and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(5-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene.
| Compound Name | 1-(5-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene |
|---|---|
| PubChem CID | 143451273 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(5-fluorocyclohexa-1,5-dien-1-yl)oxy-4-propylbenzene |
| SMILES | CCCc1ccc(OC2=CCCC(F)=C2)cc1 |
| InChI | InChI=1S/C15H17FO/c1-2-4-12-7-9-14(10-8-12)17-15-6-3-5-13(16)11-15/h6-11H,2-5H2,1H3 |
| InChIKey | UXRBBSIZGXOPNB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |