C16H20FNO3 — CID 143451373
2-[(2-fluoro-4-propylphenoxy)methyl]pyridine;methanediol (PubChem CID 143451373) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[(2-fluoro-4-propylphenoxy)methyl]pyridine;methanediol.
| Compound Name | 2-[(2-fluoro-4-propylphenoxy)methyl]pyridine;methanediol |
|---|---|
| PubChem CID | 143451373 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(2-fluoro-4-propylphenoxy)methyl]pyridine;methanediol |
| SMILES | CCCc1ccc(OCc2ccccn2)c(F)c1.OCO |
| InChI | InChI=1S/C15H16FNO.CH4O2/c1-2-5-12-7-8-15(14(16)10-12)18-11-13-6-3-4-9-17-13;2-1-3/h3-4,6-10H,2,5,11H2,1H3;2-3H,1H2 |
| InChIKey | FWPNNGAQRYYFRU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|