C34H35FN2O5 — CID 70621235
(Z)-but-2-enedioic acid;N-[1-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]propan-2-yl]-3,3-diphenylpropan-1-amine (PubChem CID 70621235) has the molecular formula C34H35FN2O5 and a molecular weight of 570.66 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[1-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]propan-2-yl]-3,3-diphenylpropan-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-[1-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]propan-2-yl]-3,3-diphenylpropan-1-amine |
|---|---|
| PubChem CID | 70621235 |
| Molecular Formula | C34H35FN2O5 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[1-[3-fluoro-4-(pyridin-2-ylmethoxy)phenyl]propan-2-yl]-3,3-diphenylpropan-1-amine |
| SMILES | CC(Cc1ccc(OCc2ccccn2)c(F)c1)NCCC(c1ccccc1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C30H31FN2O.C4H4O4/c1-23(20-24-15-16-30(29(31)21-24)34-22-27-14-8-9-18-33-27)32-19-17-28(25-10-4-2-5-11-25)26-12-6-3-7-13-26;5-3(6)1-2-4(7)8/h2-16,18,21,23,28,32H,17,19-20,22H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ZLPYDGAGUIJPMQ-BTJKTKAUSA-N |
| XLogP | 6.25 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|