C20H31BrN2OS — CID 143452821
2-bromo-N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-4-methylbenzamide (PubChem CID 143452821) has the molecular formula C20H31BrN2OS and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-bromo-N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-4-methylbenzamide.
| Compound Name | 2-bromo-N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143452821 |
| Molecular Formula | C20H31BrN2OS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-bromo-N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-4-methylbenzamide |
| SMILES | CCSN1CCC(CNC(=O)c2ccc(C)cc2Br)(CC(C)C)CC1 |
| InChI | InChI=1S/C20H31BrN2OS/c1-5-25-23-10-8-20(9-11-23,13-15(2)3)14-22-19(24)17-7-6-16(4)12-18(17)21/h6-7,12,15H,5,8-11,13-14H2,1-4H3,(H,22,24) |
| InChIKey | AESKPCURCBGWEA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|