C20H28F4N2OS — CID 143452795
N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide (PubChem CID 143452795) has the molecular formula C20H28F4N2OS and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 143452795 |
| Molecular Formula | C20H28F4N2OS |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[[1-ethylsulfanyl-4-(2-methylpropyl)piperidin-4-yl]methyl]-2-fluoro-4-(trifluoromethyl)benzamide |
| SMILES | CCSN1CCC(CNC(=O)c2ccc(C(F)(F)F)cc2F)(CC(C)C)CC1 |
| InChI | InChI=1S/C20H28F4N2OS/c1-4-28-26-9-7-19(8-10-26,12-14(2)3)13-25-18(27)16-6-5-15(11-17(16)21)20(22,23)24/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H,25,27) |
| InChIKey | FBOZVYLTVSGLAS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|