C10H16N2 — CID 143453316
N-(4-ethenyl-1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanimine (PubChem CID 143453316) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-(4-ethenyl-1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanimine.
| Compound Name | N-(4-ethenyl-1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanimine |
|---|---|
| PubChem CID | 143453316 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-(4-ethenyl-1-ethyl-3,6-dihydro-2H-pyridin-5-yl)methanimine |
| SMILES | C=CC1=C(N=C)CN(CC)CC1 |
| InChI | InChI=1S/C10H16N2/c1-4-9-6-7-12(5-2)8-10(9)11-3/h4H,1,3,5-8H2,2H3 |
| InChIKey | BIMUOUIFGYXRIT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|