C11H19NS — CID 143454063
N-[cyclohexen-1-yl(ethylsulfanyl)methyl]ethenamine (PubChem CID 143454063) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is N-[cyclohexen-1-yl(ethylsulfanyl)methyl]ethenamine.
| Compound Name | N-[cyclohexen-1-yl(ethylsulfanyl)methyl]ethenamine |
|---|---|
| PubChem CID | 143454063 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-[cyclohexen-1-yl(ethylsulfanyl)methyl]ethenamine |
| SMILES | C=CNC(SCC)C1=CCCCC1 |
| InChI | InChI=1S/C11H19NS/c1-3-12-11(13-4-2)10-8-6-5-7-9-10/h3,8,11-12H,1,4-7,9H2,2H3 |
| InChIKey | AUAPYZKNFJXJER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|