C11H17NS — CID 170286317
1-(2-ethenyl-6-methyl-3,4-dihydro-2H-thiopyran-5-yl)-N-methylethenamine (PubChem CID 170286317) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 1-(2-ethenyl-6-methyl-3,4-dihydro-2H-thiopyran-5-yl)-N-methylethenamine.
| Compound Name | 1-(2-ethenyl-6-methyl-3,4-dihydro-2H-thiopyran-5-yl)-N-methylethenamine |
|---|---|
| PubChem CID | 170286317 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-(2-ethenyl-6-methyl-3,4-dihydro-2H-thiopyran-5-yl)-N-methylethenamine |
| SMILES | C=CC1CCC(C(=C)NC)=C(C)S1 |
| InChI | InChI=1S/C11H17NS/c1-5-10-6-7-11(8(2)12-4)9(3)13-10/h5,10,12H,1-2,6-7H2,3-4H3 |
| InChIKey | GKOZNXSYWCCZOA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|