C14H22N2S — CID 139563718
(4Z,6Z)-5-N,4-bis(ethenyl)-3-methylidene-1-methylsulfanylocta-4,6-diene-1,5-diamine (PubChem CID 139563718) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is (4Z,6Z)-5-N,4-bis(ethenyl)-3-methylidene-1-methylsulfanylocta-4,6-diene-1,5-diamine.
| Compound Name | (4Z,6Z)-5-N,4-bis(ethenyl)-3-methylidene-1-methylsulfanylocta-4,6-diene-1,5-diamine |
|---|---|
| PubChem CID | 139563718 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (4Z,6Z)-5-N,4-bis(ethenyl)-3-methylidene-1-methylsulfanylocta-4,6-diene-1,5-diamine |
| SMILES | C=CNC(/C=C\C)=C(/C=C)C(=C)CC(N)SC |
| InChI | InChI=1S/C14H22N2S/c1-6-9-13(16-8-3)12(7-2)11(4)10-14(15)17-5/h6-9,14,16H,2-4,10,15H2,1,5H3/b9-6-,13-12- |
| InChIKey | CJBWUYKOUYRRMW-IIBIBAHBSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|