C10H17NS — CID 134516437
(2E,4Z)-N-methyl-6-(methylsulfanylmethyl)hepta-2,4,6-trien-3-amine (PubChem CID 134516437) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is (2E,4Z)-N-methyl-6-(methylsulfanylmethyl)hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-methyl-6-(methylsulfanylmethyl)hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 134516437 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (2E,4Z)-N-methyl-6-(methylsulfanylmethyl)hepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(=C/C)NC)CSC |
| InChI | InChI=1S/C10H17NS/c1-5-10(11-3)7-6-9(2)8-12-4/h5-7,11H,2,8H2,1,3-4H3/b7-6-,10-5+ |
| InChIKey | HAKILGXRKVJDTI-JQEGGOPCSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|