About (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine
(Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine (PubChem CID 176949668) has the molecular formula C10H14FNS
and a molecular weight of 199.29 g/mol. Its IUPAC name is (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine.
Molecular Properties
| Compound Name | (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine |
| PubChem CID | 176949668 |
| Molecular Formula | C10H14FNS |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine |
| SMILES | C=CC1=C(/C(F)=C(\C)NC)CSC1 |
| InChI | InChI=1S/C10H14FNS/c1-4-8-5-13-6-9(8)10(11)7(2)12-3/h4,12H,1,5-6H2,2-3H3/b10-7- |
| InChIKey | DVJKHAKITBGOEQ-YFHOEESVSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine?
The IUPAC name of (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine (CID 176949668) is (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine.
What is the SMILES notation for (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine?
The canonical SMILES for (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine is C=CC1=C(/C(F)=C(\C)NC)CSC1.
What is the InChIKey of (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine?
The InChIKey is DVJKHAKITBGOEQ-YFHOEESVSA-N. The full InChI is InChI=1S/C10H14FNS/c1-4-8-5-13-6-9(8)10(11)7(2)12-3/h4,12H,1,5-6H2,2-3H3/b10-7-.
What are the key properties of (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine?
(Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine has a molecular weight of 199.29 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-ethenyl-2,5-dihydrothiophen-3-yl)-1-fluoro-N-methylprop-1-en-2-amine is sourced from PubChem (CID 176949668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).