C12H22N2S — CID 143719097
(1E)-1-[(3Z)-3-(1-aminoethylidene)thiophen-2-ylidene]-N-methylpropan-1-amine;ethane (PubChem CID 143719097) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is (1E)-1-[(3Z)-3-(1-aminoethylidene)thiophen-2-ylidene]-N-methylpropan-1-amine;ethane.
| Compound Name | (1E)-1-[(3Z)-3-(1-aminoethylidene)thiophen-2-ylidene]-N-methylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 143719097 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (1E)-1-[(3Z)-3-(1-aminoethylidene)thiophen-2-ylidene]-N-methylpropan-1-amine;ethane |
| SMILES | CC.CC/C(NC)=c1\scc\c1=C(/C)N |
| InChI | InChI=1S/C10H16N2S.C2H6/c1-4-9(12-3)10-8(7(2)11)5-6-13-10;1-2/h5-6,12H,4,11H2,1-3H3;1-2H3/b8-7-,10-9+; |
| InChIKey | MDMWFCHJQFXBQY-AXEASZOCSA-N |
| XLogP | 1.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |