C12H24N2S — CID 168964961
methanamine;(3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine (PubChem CID 168964961) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is methanamine;(3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine.
| Compound Name | methanamine;(3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 168964961 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methanamine;(3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(=C\C=C/C)NCCSC.CN |
| InChI | InChI=1S/C11H19NS.CH5N/c1-5-6-7-11(10(2)3)12-8-9-13-4;1-2/h5-7,12H,2,8-9H2,1,3-4H3;2H2,1H3/b6-5-,11-7+; |
| InChIKey | CSTJXKMAMPWLLZ-ZHWADORCSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|