C18H25NS — CID 142584708
(2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-methylnona-2,4,7-trien-2-amine (PubChem CID 142584708) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-methylnona-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-methylnona-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142584708 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2E,4Z,6E,7Z)-4-buta-1,3-dien-2-yl-7-ethenylsulfanyl-6-ethylidene-N-methylnona-2,4,7-trien-2-amine |
| SMILES | C=CSC(=C\C)/C(C=C(/C=C(\C)NC)C(=C)C=C)=C/C |
| InChI | InChI=1S/C18H25NS/c1-8-14(5)17(12-15(6)19-7)13-16(9-2)18(10-3)20-11-4/h8-13,19H,1,4-5H2,2-3,6-7H3/b15-12+,16-9+,17-13-,18-10- |
| InChIKey | LOQYEEDTBZJSMT-FWNIWQMSSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|