C11H19NS — CID 168964962
(3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine (PubChem CID 168964962) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is (3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 168964962 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | (3E,5Z)-2-methyl-N-(2-methylsulfanylethyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(=C\C=C/C)NCCSC |
| InChI | InChI=1S/C11H19NS/c1-5-6-7-11(10(2)3)12-8-9-13-4/h5-7,12H,2,8-9H2,1,3-4H3/b6-5-,11-7+ |
| InChIKey | PNJLRHLREGSVOY-GNLLZQBYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|