C10H19NS — CID 123940785
1-(6-methylhepta-3,5-dien-2-ylamino)ethanethiol (PubChem CID 123940785) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 1-(6-methylhepta-3,5-dien-2-ylamino)ethanethiol.
| Compound Name | 1-(6-methylhepta-3,5-dien-2-ylamino)ethanethiol |
|---|---|
| PubChem CID | 123940785 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-(6-methylhepta-3,5-dien-2-ylamino)ethanethiol |
| SMILES | CC(C)=CC=CC(C)NC(C)S |
| InChI | InChI=1S/C10H19NS/c1-8(2)6-5-7-9(3)11-10(4)12/h5-7,9-12H,1-4H3 |
| InChIKey | FOMKUXZAPLKTIH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|