About (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine
(4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine (PubChem CID 144626603) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine.
Analyze (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine?
The IUPAC name of (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine (CID 144626603) is (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine.
What is the SMILES notation for (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine?
The canonical SMILES for (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine is C/C=c1/c(NC)cs/c1=C/C.
What is the InChIKey of (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine?
The InChIKey is XCJNDHJTEJZHRO-ICDOWURLSA-N. The full InChI is InChI=1S/C9H13NS/c1-4-7-8(10-3)6-11-9(7)5-2/h4-6,10H,1-3H3/b7-4-,9-5+.
What are the key properties of (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine?
(4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine has a molecular weight of 167.28 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-4,5-di(ethylidene)-N-methylthiophen-3-amine is sourced from PubChem (CID 144626603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).