C11H15NS — CID 167071691
2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-2,3-dihydro-1,3-thiazole (PubChem CID 167071691) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-2,3-dihydro-1,3-thiazole.
| Compound Name | 2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 167071691 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(3Z,5Z)-octa-1,3,5-trien-2-yl]-2,3-dihydro-1,3-thiazole |
| SMILES | C=C(/C=C\C=C/CC)C1NC=CS1 |
| InChI | InChI=1S/C11H15NS/c1-3-4-5-6-7-10(2)11-12-8-9-13-11/h4-9,11-12H,2-3H2,1H3/b5-4-,7-6- |
| InChIKey | UOCDBPJJETVXRJ-RZSVFLSASA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|