C7H7NS — CID 22507173
7,7a-dihydrothieno[2,3-b]pyridine (PubChem CID 22507173) has the molecular formula C7H7NS and a molecular weight of 137.21 g/mol. Its IUPAC name is 7,7a-dihydrothieno[2,3-b]pyridine.
| Compound Name | 7,7a-dihydrothieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 22507173 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 7,7a-dihydrothieno[2,3-b]pyridine |
| SMILES | C1=CNC2SC=CC2=C1 |
| InChI | InChI=1S/C7H7NS/c1-2-6-3-5-9-7(6)8-4-1/h1-5,7-8H |
| InChIKey | WZQAFBMFSLHVEP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |