C22H33NS — CID 142583792
(2E,4Z,6E,7Z)-7-[(E)-but-1-enyl]sulfanyl-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-N-methylnona-2,4,7-trien-2-amine (PubChem CID 142583792) has the molecular formula C22H33NS and a molecular weight of 343.58 g/mol. Its IUPAC name is (2E,4Z,6E,7Z)-7-[(E)-but-1-enyl]sulfanyl-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-N-methylnona-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z,6E,7Z)-7-[(E)-but-1-enyl]sulfanyl-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-N-methylnona-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142583792 |
| Molecular Formula | C22H33NS |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (2E,4Z,6E,7Z)-7-[(E)-but-1-enyl]sulfanyl-6-ethylidene-4-[(3E)-hexa-1,3-dien-3-yl]-N-methylnona-2,4,7-trien-2-amine |
| SMILES | C=C/C(=C\CC)C(=CC(=C\C)/C(=C/C)S/C=C/CC)/C=C(\C)NC |
| InChI | InChI=1S/C22H33NS/c1-8-13-15-24-22(12-5)20(11-4)17-21(16-18(6)23-7)19(10-3)14-9-2/h10-17,23H,3,8-9H2,1-2,4-7H3/b15-13+,18-16+,19-14+,20-11+,21-17-,22-12- |
| InChIKey | UEOLNMUMNVWFMK-YGDCGUPWSA-N |
| XLogP | 7.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|