C14H17FN2OS — CID 143454822
(2E,4E)-2-ethenyl-4-fluoro-N-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]hexa-2,4-dienamide (PubChem CID 143454822) has the molecular formula C14H17FN2OS and a molecular weight of 280.37 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-4-fluoro-N-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-2-ethenyl-4-fluoro-N-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 143454822 |
| Molecular Formula | C14H17FN2OS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (2E,4E)-2-ethenyl-4-fluoro-N-[2-(2-methyl-1,3-thiazol-5-yl)ethyl]hexa-2,4-dienamide |
| SMILES | C=C/C(=C\C(F)=C/C)C(=O)NCCc1cnc(C)s1 |
| InChI | InChI=1S/C14H17FN2OS/c1-4-11(8-12(15)5-2)14(18)16-7-6-13-9-17-10(3)19-13/h4-5,8-9H,1,6-7H2,2-3H3,(H,16,18)/b11-8+,12-5+ |
| InChIKey | UTTRYBHNYITYFJ-OEBNHILSSA-N |
| XLogP | 3.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|