C10H10N2OS — CID 143483106
4-methyl-6-(1,3-thiazol-5-yl)-1,2-dihydroazepin-7-one (PubChem CID 143483106) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 4-methyl-6-(1,3-thiazol-5-yl)-1,2-dihydroazepin-7-one.
| Compound Name | 4-methyl-6-(1,3-thiazol-5-yl)-1,2-dihydroazepin-7-one |
|---|---|
| PubChem CID | 143483106 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-methyl-6-(1,3-thiazol-5-yl)-1,2-dihydroazepin-7-one |
| SMILES | CC1=CCNC(=O)C(c2cncs2)=C1 |
| InChI | InChI=1S/C10H10N2OS/c1-7-2-3-12-10(13)8(4-7)9-5-11-6-14-9/h2,4-6H,3H2,1H3,(H,12,13) |
| InChIKey | CUYINPIDSACZIG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |