C10H12F3NOS — CID 143458448
3,3,3-trifluoro-N-(6-methyl-4-sulfanylcyclohexa-1,3-dien-1-yl)propanamide (PubChem CID 143458448) has the molecular formula C10H12F3NOS and a molecular weight of 251.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(6-methyl-4-sulfanylcyclohexa-1,3-dien-1-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(6-methyl-4-sulfanylcyclohexa-1,3-dien-1-yl)propanamide |
|---|---|
| PubChem CID | 143458448 |
| Molecular Formula | C10H12F3NOS |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3,3,3-trifluoro-N-(6-methyl-4-sulfanylcyclohexa-1,3-dien-1-yl)propanamide |
| SMILES | CC1CC(S)=CC=C1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C10H12F3NOS/c1-6-4-7(16)2-3-8(6)14-9(15)5-10(11,12)13/h2-3,6,16H,4-5H2,1H3,(H,14,15) |
| InChIKey | IDNZTHWPHAQYBZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|