C25H27N7O2S2 — CID 143460781
5-[[3-(5-cyanofuran-3-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,N-diethyl-3-methylthiophene-2-sulfinamide (PubChem CID 143460781) has the molecular formula C25H27N7O2S2 and a molecular weight of 521.67 g/mol. Its IUPAC name is 5-[[3-(5-cyanofuran-3-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,N-diethyl-3-methylthiophene-2-sulfinamide.
| Compound Name | 5-[[3-(5-cyanofuran-3-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,N-diethyl-3-methylthiophene-2-sulfinamide |
|---|---|
| PubChem CID | 143460781 |
| Molecular Formula | C25H27N7O2S2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 5-[[3-(5-cyanofuran-3-yl)-6-(1,2,3,6-tetrahydropyridin-5-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N,N-diethyl-3-methylthiophene-2-sulfinamide |
| SMILES | CCN(CC)S(=O)c1sc(Nc2nc(C3=CCCNC3)cn3c(-c4coc(C#N)c4)cnc23)cc1C |
| InChI | InChI=1S/C25H27N7O2S2/c1-4-31(5-2)36(33)25-16(3)9-22(35-25)30-23-24-28-13-21(18-10-19(11-26)34-15-18)32(24)14-20(29-23)17-7-6-8-27-12-17/h7,9-10,13-15,27H,4-6,8,12H2,1-3H3,(H,29,30) |
| InChIKey | IABRPUFELFVIOT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |